C12H17F3N2O2S — CID 67161162
3-(aminomethyl)-N-tert-butyl-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 67161162) has the molecular formula C12H17F3N2O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is 3-(aminomethyl)-N-tert-butyl-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-N-tert-butyl-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 67161162 |
| Molecular Formula | C12H17F3N2O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-(aminomethyl)-N-tert-butyl-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cc(CN)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H17F3N2O2S/c1-11(2,3)17-20(18,19)10-5-8(7-16)4-9(6-10)12(13,14)15/h4-6,17H,7,16H2,1-3H3 |
| InChIKey | KJTSPXNOMGNGLM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |