C28H20BrF3HgO3P — CID 11228064
[2-(4-bromophenyl)-2-oxo-1-(triphenyl-lambda5-phosphanylidene)ethyl]mercury;2,2,2-trifluoroacetic acid (PubChem CID 11228064) has the molecular formula C28H20BrF3HgO3P and a molecular weight of 772.93 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxo-1-(triphenyl-lambda5-phosphanylidene)ethyl]mercury;2,2,2-trifluoroacetic acid.
| Compound Name | [2-(4-bromophenyl)-2-oxo-1-(triphenyl-lambda5-phosphanylidene)ethyl]mercury;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 11228064 |
| Molecular Formula | C28H20BrF3HgO3P |
| Molecular Weight | 772.93 g/mol |
| Exact Mass | 773.00 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxo-1-(triphenyl-lambda5-phosphanylidene)ethyl]mercury;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C([Hg])=P(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc(Br)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H19BrOP.C2HF3O2.Hg/c27-22-18-16-21(17-19-22)26(28)20-29(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25;3-2(4,5)1(6)7;/h1-19H;(H,6,7); |
| InChIKey | OXFJRBMNBHLPOQ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.93 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|