C29H24O — CID 101103780
(E)-1,2,4,4-tetraphenylpent-2-en-1-one (PubChem CID 101103780) has the molecular formula C29H24O and a molecular weight of 388.51 g/mol. Its IUPAC name is (E)-1,2,4,4-tetraphenylpent-2-en-1-one.
| Compound Name | (E)-1,2,4,4-tetraphenylpent-2-en-1-one |
|---|---|
| PubChem CID | 101103780 |
| Molecular Formula | C29H24O |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (E)-1,2,4,4-tetraphenylpent-2-en-1-one |
| SMILES | CC(/C=C(/C(=O)c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H24O/c1-29(25-18-10-4-11-19-25,26-20-12-5-13-21-26)22-27(23-14-6-2-7-15-23)28(30)24-16-8-3-9-17-24/h2-22H,1H3/b27-22+ |
| InChIKey | VRNVAQGCFRKYQU-HPNDGRJYSA-N |
| XLogP | 6.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|