C9H5F3N2O — CID 162513302
2-diazo-3,3,3-trifluoro-1-phenylpropan-1-one (PubChem CID 162513302) has the molecular formula C9H5F3N2O and a molecular weight of 214.15 g/mol. Its IUPAC name is 2-diazo-3,3,3-trifluoro-1-phenylpropan-1-one.
| Compound Name | 2-diazo-3,3,3-trifluoro-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 162513302 |
| Molecular Formula | C9H5F3N2O |
| Molecular Weight | 214.15 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-diazo-3,3,3-trifluoro-1-phenylpropan-1-one |
| SMILES | [N-]=[N+]=C(C(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C9H5F3N2O/c10-9(11,12)8(14-13)7(15)6-4-2-1-3-5-6/h1-5H |
| InChIKey | ZEBYZUBYMYDQQX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.15 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|