C12H10F3N3O3 — CID 102426838
(2S)-2-[(2-diazo-3,3,3-trifluoropropanoyl)amino]-3-phenylpropanoic acid (PubChem CID 102426838) has the molecular formula C12H10F3N3O3 and a molecular weight of 301.22 g/mol. Its IUPAC name is (2S)-2-[(2-diazo-3,3,3-trifluoropropanoyl)amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(2-diazo-3,3,3-trifluoropropanoyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 102426838 |
| Molecular Formula | C12H10F3N3O3 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (2S)-2-[(2-diazo-3,3,3-trifluoropropanoyl)amino]-3-phenylpropanoic acid |
| SMILES | [N-]=[N+]=C(C(=O)N[C@@H](Cc1ccccc1)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C12H10F3N3O3/c13-12(14,15)9(18-16)10(19)17-8(11(20)21)6-7-4-2-1-3-5-7/h1-5,8H,6H2,(H,17,19)(H,20,21)/t8-/m0/s1 |
| InChIKey | NKINYIAWLPEJAS-QMMMGPOBSA-N |
| XLogP | 1.03 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|