About 2-oxo-2-phenylacetyl azide
2-oxo-2-phenylacetyl azide (PubChem CID 54447915) has the molecular formula C8H5N3O2
and a molecular weight of 175.15 g/mol. Its IUPAC name is 2-oxo-2-phenylacetyl azide.
Molecular Properties
| Compound Name | 2-oxo-2-phenylacetyl azide |
| PubChem CID | 54447915 |
| Molecular Formula | C8H5N3O2 |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | 2-oxo-2-phenylacetyl azide |
| SMILES | [N-]=[N+]=NC(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C8H5N3O2/c9-11-10-8(13)7(12)6-4-2-1-3-5-6/h1-5H |
| InChIKey | WSVUUWAVXJQEBW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-2-phenylacetyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-2-phenylacetyl azide?
The IUPAC name of 2-oxo-2-phenylacetyl azide (CID 54447915) is 2-oxo-2-phenylacetyl azide.
What is the SMILES notation for 2-oxo-2-phenylacetyl azide?
The canonical SMILES for 2-oxo-2-phenylacetyl azide is [N-]=[N+]=NC(=O)C(=O)c1ccccc1.
What is the InChIKey of 2-oxo-2-phenylacetyl azide?
The InChIKey is WSVUUWAVXJQEBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O2/c9-11-10-8(13)7(12)6-4-2-1-3-5-6/h1-5H.
What are the key properties of 2-oxo-2-phenylacetyl azide?
2-oxo-2-phenylacetyl azide has a molecular weight of 175.15 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-2-phenylacetyl azide is sourced from PubChem (CID 54447915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).