C15H10N6O4S — CID 175776259
2-[(E)-1,2-diazido-3-oxo-3-phenylprop-1-enyl]benzenesulfonic acid (PubChem CID 175776259) has the molecular formula C15H10N6O4S and a molecular weight of 370.35 g/mol. Its IUPAC name is 2-[(E)-1,2-diazido-3-oxo-3-phenylprop-1-enyl]benzenesulfonic acid.
| Compound Name | 2-[(E)-1,2-diazido-3-oxo-3-phenylprop-1-enyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 175776259 |
| Molecular Formula | C15H10N6O4S |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 2-[(E)-1,2-diazido-3-oxo-3-phenylprop-1-enyl]benzenesulfonic acid |
| SMILES | [N-]=[N+]=N/C(C(=O)c1ccccc1)=C(/N=[N+]=[N-])c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C15H10N6O4S/c16-20-18-13(11-8-4-5-9-12(11)26(23,24)25)14(19-21-17)15(22)10-6-2-1-3-7-10/h1-9H,(H,23,24,25)/b14-13+ |
| InChIKey | LTSCMMWKYAYUBV-BUHFOSPRSA-N |
| XLogP | 4.11 |
| TPSA | 168.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|