C41H42F4N2O2 — CID 145337069
(1E,8E)-1,9-bis(N-ethylanilino)-4,4,6,6-tetrafluoro-5-methylidene-2,8-diphenylnona-1,8-diene-3,7-dione;propane (PubChem CID 145337069) has the molecular formula C41H42F4N2O2 and a molecular weight of 670.79 g/mol. Its IUPAC name is (1E,8E)-1,9-bis(N-ethylanilino)-4,4,6,6-tetrafluoro-5-methylidene-2,8-diphenylnona-1,8-diene-3,7-dione;propane.
| Compound Name | (1E,8E)-1,9-bis(N-ethylanilino)-4,4,6,6-tetrafluoro-5-methylidene-2,8-diphenylnona-1,8-diene-3,7-dione;propane |
|---|---|
| PubChem CID | 145337069 |
| Molecular Formula | C41H42F4N2O2 |
| Molecular Weight | 670.79 g/mol |
| Exact Mass | 670.32 |
| IUPAC Name | (1E,8E)-1,9-bis(N-ethylanilino)-4,4,6,6-tetrafluoro-5-methylidene-2,8-diphenylnona-1,8-diene-3,7-dione;propane |
| SMILES | C=C(C(F)(F)C(=O)/C(=C/N(CC)c1ccccc1)c1ccccc1)C(F)(F)C(=O)/C(=C/N(CC)c1ccccc1)c1ccccc1.CCC |
| InChI | InChI=1S/C38H34F4N2O2.C3H8/c1-4-43(31-22-14-8-15-23-31)26-33(29-18-10-6-11-19-29)35(45)37(39,40)28(3)38(41,42)36(46)34(30-20-12-7-13-21-30)27-44(5-2)32-24-16-9-17-25-32;1-3-2/h6-27H,3-5H2,1-2H3;3H2,1-2H3/b33-26+,34-27+; |
| InChIKey | HEYWSBOIPLPZFP-FOGIKLLESA-N |
| XLogP | 10.50 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.79 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|