C20H22N2O2 — CID 129293986
(E)-4-(N-ethylanilino)-N,N-dimethyl-2-oxo-3-phenylbut-3-enamide (PubChem CID 129293986) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (E)-4-(N-ethylanilino)-N,N-dimethyl-2-oxo-3-phenylbut-3-enamide.
| Compound Name | (E)-4-(N-ethylanilino)-N,N-dimethyl-2-oxo-3-phenylbut-3-enamide |
|---|---|
| PubChem CID | 129293986 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (E)-4-(N-ethylanilino)-N,N-dimethyl-2-oxo-3-phenylbut-3-enamide |
| SMILES | CCN(/C=C(/C(=O)C(=O)N(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O2/c1-4-22(17-13-9-6-10-14-17)15-18(16-11-7-5-8-12-16)19(23)20(24)21(2)3/h5-15H,4H2,1-3H3/b18-15+ |
| InChIKey | AOXBKDZVFMSRMI-OBGWFSINSA-N |
| XLogP | 3.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|