C13H12F3N5O — CID 2780790
(Z)-4-(dimethylamino)-1,1,1-trifluoro-3-(1-phenyltetrazol-5-yl)but-3-en-2-one (PubChem CID 2780790) has the molecular formula C13H12F3N5O and a molecular weight of 311.27 g/mol. Its IUPAC name is (Z)-4-(dimethylamino)-1,1,1-trifluoro-3-(1-phenyltetrazol-5-yl)but-3-en-2-one.
| Compound Name | (Z)-4-(dimethylamino)-1,1,1-trifluoro-3-(1-phenyltetrazol-5-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 2780790 |
| Molecular Formula | C13H12F3N5O |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (Z)-4-(dimethylamino)-1,1,1-trifluoro-3-(1-phenyltetrazol-5-yl)but-3-en-2-one |
| SMILES | CN(C)/C=C(\C(=O)C(F)(F)F)c1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C13H12F3N5O/c1-20(2)8-10(11(22)13(14,15)16)12-17-18-19-21(12)9-6-4-3-5-7-9/h3-8H,1-2H3/b10-8+ |
| InChIKey | FGVUKFBPSJLUDT-CSKARUKUSA-N |
| XLogP | 1.70 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|