C20H18F3N5O — CID 6108591
(Z)-3-(dimethylamino)-2-[1-(4-methylphenyl)tetrazol-5-yl]-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 6108591) has the molecular formula C20H18F3N5O and a molecular weight of 401.39 g/mol. Its IUPAC name is (Z)-3-(dimethylamino)-2-[1-(4-methylphenyl)tetrazol-5-yl]-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (Z)-3-(dimethylamino)-2-[1-(4-methylphenyl)tetrazol-5-yl]-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 6108591 |
| Molecular Formula | C20H18F3N5O |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | (Z)-3-(dimethylamino)-2-[1-(4-methylphenyl)tetrazol-5-yl]-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | Cc1ccc(-n2nnnc2/C(=C/N(C)C)C(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H18F3N5O/c1-13-7-9-16(10-8-13)28-19(24-25-26-28)17(12-27(2)3)18(29)14-5-4-6-15(11-14)20(21,22)23/h4-12H,1-3H3/b17-12+ |
| InChIKey | UDYHJQRQJAMIQH-SFQUDFHCSA-N |
| XLogP | 3.77 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|