C14H16BrN5O — CID 98093019
(Z,4R)-4-bromo-1-(dimethylamino)-2-(1-phenyltetrazol-5-yl)pent-1-en-3-one (PubChem CID 98093019) has the molecular formula C14H16BrN5O and a molecular weight of 350.22 g/mol. Its IUPAC name is (Z,4R)-4-bromo-1-(dimethylamino)-2-(1-phenyltetrazol-5-yl)pent-1-en-3-one.
| Compound Name | (Z,4R)-4-bromo-1-(dimethylamino)-2-(1-phenyltetrazol-5-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 98093019 |
| Molecular Formula | C14H16BrN5O |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | (Z,4R)-4-bromo-1-(dimethylamino)-2-(1-phenyltetrazol-5-yl)pent-1-en-3-one |
| SMILES | C[C@@H](Br)C(=O)/C(=C\N(C)C)c1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C14H16BrN5O/c1-10(15)13(21)12(9-19(2)3)14-16-17-18-20(14)11-7-5-4-6-8-11/h4-10H,1-3H3/b12-9+/t10-/m1/s1 |
| InChIKey | GKAPLSRTOMGOKC-QSARLWQPSA-N |
| XLogP | 1.92 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|