C13H11F4N5O — CID 2780793
(Z)-4-(dimethylamino)-1,1,1-trifluoro-3-[1-(4-fluorophenyl)tetrazol-5-yl]but-3-en-2-one (PubChem CID 2780793) has the molecular formula C13H11F4N5O and a molecular weight of 329.26 g/mol. Its IUPAC name is (Z)-4-(dimethylamino)-1,1,1-trifluoro-3-[1-(4-fluorophenyl)tetrazol-5-yl]but-3-en-2-one.
| Compound Name | (Z)-4-(dimethylamino)-1,1,1-trifluoro-3-[1-(4-fluorophenyl)tetrazol-5-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 2780793 |
| Molecular Formula | C13H11F4N5O |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (Z)-4-(dimethylamino)-1,1,1-trifluoro-3-[1-(4-fluorophenyl)tetrazol-5-yl]but-3-en-2-one |
| SMILES | CN(C)/C=C(\C(=O)C(F)(F)F)c1nnnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C13H11F4N5O/c1-21(2)7-10(11(23)13(15,16)17)12-18-19-20-22(12)9-5-3-8(14)4-6-9/h3-7H,1-2H3/b10-7+ |
| InChIKey | BYDUZBZDQCXLQL-JXMROGBWSA-N |
| XLogP | 1.84 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|