C18H15F2N5O — CID 20835075
(E)-1-(2,4-difluorophenyl)-3-(dimethylamino)-2-(1-phenyltetrazol-5-yl)prop-2-en-1-one (PubChem CID 20835075) has the molecular formula C18H15F2N5O and a molecular weight of 355.35 g/mol. Its IUPAC name is (E)-1-(2,4-difluorophenyl)-3-(dimethylamino)-2-(1-phenyltetrazol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-difluorophenyl)-3-(dimethylamino)-2-(1-phenyltetrazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 20835075 |
| Molecular Formula | C18H15F2N5O |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | (E)-1-(2,4-difluorophenyl)-3-(dimethylamino)-2-(1-phenyltetrazol-5-yl)prop-2-en-1-one |
| SMILES | CN(C)/C=C(/C(=O)c1ccc(F)cc1F)c1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C18H15F2N5O/c1-24(2)11-15(17(26)14-9-8-12(19)10-16(14)20)18-21-22-23-25(18)13-6-4-3-5-7-13/h3-11H,1-2H3/b15-11- |
| InChIKey | VYGPEAILNMPSRC-PTNGSMBKSA-N |
| XLogP | 2.73 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|