C20H21N3O3 — CID 88828938
(E,2E)-4-morpholin-4-yl-3-phenyl-2-(phenylhydrazinylidene)but-3-enoic acid (PubChem CID 88828938) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is (E,2E)-4-morpholin-4-yl-3-phenyl-2-(phenylhydrazinylidene)but-3-enoic acid.
| Compound Name | (E,2E)-4-morpholin-4-yl-3-phenyl-2-(phenylhydrazinylidene)but-3-enoic acid |
|---|---|
| PubChem CID | 88828938 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (E,2E)-4-morpholin-4-yl-3-phenyl-2-(phenylhydrazinylidene)but-3-enoic acid |
| SMILES | O=C(O)C(=N/Nc1ccccc1)/C(=C/N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O3/c24-20(25)19(22-21-17-9-5-2-6-10-17)18(16-7-3-1-4-8-16)15-23-11-13-26-14-12-23/h1-10,15,21H,11-14H2,(H,24,25)/b18-15+,22-19+ |
| InChIKey | NTRZXRLXIXWJGK-RLZVDVMKSA-N |
| XLogP | 2.91 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|