C21H23N3O3 — CID 21418474
(E,2Z)-2-[(4-methylphenyl)hydrazinylidene]-4-morpholin-4-yl-3-phenylbut-3-enoic acid (PubChem CID 21418474) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is (E,2Z)-2-[(4-methylphenyl)hydrazinylidene]-4-morpholin-4-yl-3-phenylbut-3-enoic acid.
| Compound Name | (E,2Z)-2-[(4-methylphenyl)hydrazinylidene]-4-morpholin-4-yl-3-phenylbut-3-enoic acid |
|---|---|
| PubChem CID | 21418474 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (E,2Z)-2-[(4-methylphenyl)hydrazinylidene]-4-morpholin-4-yl-3-phenylbut-3-enoic acid |
| SMILES | Cc1ccc(N/N=C(C(=O)O)/C(=C/N2CCOCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23N3O3/c1-16-7-9-18(10-8-16)22-23-20(21(25)26)19(17-5-3-2-4-6-17)15-24-11-13-27-14-12-24/h2-10,15,22H,11-14H2,1H3,(H,25,26)/b19-15+,23-20- |
| InChIKey | JDJHUNOWWQTKMZ-DLDLJLHQSA-N |
| XLogP | 3.22 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|