C18H24N2O2S — CID 87662755
(Z)-2-(4-methylphenyl)-1,3-dimorpholin-4-ylprop-2-ene-1-thione (PubChem CID 87662755) has the molecular formula C18H24N2O2S and a molecular weight of 332.47 g/mol. Its IUPAC name is (Z)-2-(4-methylphenyl)-1,3-dimorpholin-4-ylprop-2-ene-1-thione.
| Compound Name | (Z)-2-(4-methylphenyl)-1,3-dimorpholin-4-ylprop-2-ene-1-thione |
|---|---|
| PubChem CID | 87662755 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (Z)-2-(4-methylphenyl)-1,3-dimorpholin-4-ylprop-2-ene-1-thione |
| SMILES | Cc1ccc(/C(=C/N2CCOCC2)C(=S)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H24N2O2S/c1-15-2-4-16(5-3-15)17(14-19-6-10-21-11-7-19)18(23)20-8-12-22-13-9-20/h2-5,14H,6-13H2,1H3/b17-14- |
| InChIKey | MRDPSIHQCLWUAK-VKAVYKQESA-N |
| XLogP | 2.33 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|