C18H24N2O3S — CID 51682770
2-(4-methoxyphenyl)-1,3-dimorpholin-4-ylprop-2-ene-1-thione (PubChem CID 51682770) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1,3-dimorpholin-4-ylprop-2-ene-1-thione.
| Compound Name | 2-(4-methoxyphenyl)-1,3-dimorpholin-4-ylprop-2-ene-1-thione |
|---|---|
| PubChem CID | 51682770 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-(4-methoxyphenyl)-1,3-dimorpholin-4-ylprop-2-ene-1-thione |
| SMILES | COc1ccc(C(=CN2CCOCC2)C(=S)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H24N2O3S/c1-21-16-4-2-15(3-5-16)17(14-19-6-10-22-11-7-19)18(24)20-8-12-23-13-9-20/h2-5,14H,6-13H2,1H3 |
| InChIKey | OBOWGYKMGRGDJE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|