C13H13Br2NO3 — CID 569666
2,2-dibromo-1-morpholin-4-yl-3-phenylpropane-1,3-dione (PubChem CID 569666) has the molecular formula C13H13Br2NO3 and a molecular weight of 391.06 g/mol. Its IUPAC name is 2,2-dibromo-1-morpholin-4-yl-3-phenylpropane-1,3-dione.
| Compound Name | 2,2-dibromo-1-morpholin-4-yl-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 569666 |
| Molecular Formula | C13H13Br2NO3 |
| Molecular Weight | 391.06 g/mol |
| Exact Mass | 388.93 |
| IUPAC Name | 2,2-dibromo-1-morpholin-4-yl-3-phenylpropane-1,3-dione |
| SMILES | O=C(c1ccccc1)C(Br)(Br)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C13H13Br2NO3/c14-13(15,11(17)10-4-2-1-3-5-10)12(18)16-6-8-19-9-7-16/h1-5H,6-9H2 |
| InChIKey | DGNFFVORWLCEEU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.06 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|