About 4-[(E)-2-nitroso-1,2-diphenylethenyl]morpholine;hydrochloride
4-[(E)-2-nitroso-1,2-diphenylethenyl]morpholine;hydrochloride (PubChem CID 54603340) has the molecular formula C18H19ClN2O2
and a molecular weight of 330.81 g/mol. Its IUPAC name is 4-[(E)-2-nitroso-1,2-diphenylethenyl]morpholine;hydrochloride.
Molecular Properties
| Compound Name | 4-[(E)-2-nitroso-1,2-diphenylethenyl]morpholine;hydrochloride |
| PubChem CID | 54603340 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 4-[(E)-2-nitroso-1,2-diphenylethenyl]morpholine;hydrochloride |
| SMILES | Cl.O=N/C(=C(\c1ccccc1)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O2.ClH/c21-19-17(15-7-3-1-4-8-15)18(16-9-5-2-6-10-16)20-11-13-22-14-12-20;/h1-10H,11-14H2;1H/b18-17+; |
| InChIKey | WDMWZOJVWNAOFN-ZAGWXBKKSA-N |
| XLogP | 4.03 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-nitroso-1,2-diphenylethenyl]morpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-nitroso-1,2-diphenylethenyl]morpholine;hydrochloride?
The IUPAC name of 4-[(E)-2-nitroso-1,2-diphenylethenyl]morpholine;hydrochloride (CID 54603340) is 4-[(E)-2-nitroso-1,2-diphenylethenyl]morpholine;hydrochloride.
What is the SMILES notation for 4-[(E)-2-nitroso-1,2-diphenylethenyl]morpholine;hydrochloride?
The canonical SMILES for 4-[(E)-2-nitroso-1,2-diphenylethenyl]morpholine;hydrochloride is Cl.O=N/C(=C(\c1ccccc1)N1CCOCC1)c1ccccc1.
What is the InChIKey of 4-[(E)-2-nitroso-1,2-diphenylethenyl]morpholine;hydrochloride?
The InChIKey is WDMWZOJVWNAOFN-ZAGWXBKKSA-N. The full InChI is InChI=1S/C18H18N2O2.ClH/c21-19-17(15-7-3-1-4-8-15)18(16-9-5-2-6-10-16)20-11-13-22-14-12-20;/h1-10H,11-14H2;1H/b18-17+;.
What are the key properties of 4-[(E)-2-nitroso-1,2-diphenylethenyl]morpholine;hydrochloride?
4-[(E)-2-nitroso-1,2-diphenylethenyl]morpholine;hydrochloride has a molecular weight of 330.81 g/mol, XLogP of 4.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-nitroso-1,2-diphenylethenyl]morpholine;hydrochloride is sourced from PubChem (CID 54603340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).