About (2Z,3Z)-2,3-bis(hydroxyimino)-3-morpholin-4-yl-1-phenylpropan-1-one
(2Z,3Z)-2,3-bis(hydroxyimino)-3-morpholin-4-yl-1-phenylpropan-1-one (PubChem CID 137153092) has the molecular formula C13H15N3O4
and a molecular weight of 277.28 g/mol. Its IUPAC name is (2Z,3Z)-2,3-bis(hydroxyimino)-3-morpholin-4-yl-1-phenylpropan-1-one.
Molecular Properties
| Compound Name | (2Z,3Z)-2,3-bis(hydroxyimino)-3-morpholin-4-yl-1-phenylpropan-1-one |
| PubChem CID | 137153092 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (2Z,3Z)-2,3-bis(hydroxyimino)-3-morpholin-4-yl-1-phenylpropan-1-one |
| SMILES | O=C(C(=N\O)/C(=N/O)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C13H15N3O4/c17-12(10-4-2-1-3-5-10)11(14-18)13(15-19)16-6-8-20-9-7-16/h1-5,18-19H,6-9H2/b14-11+,15-13- |
| InChIKey | QKBWAOXQNRKNRK-HKHVJCFFSA-N |
| XLogP | 0.82 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z,3Z)-2,3-bis(hydroxyimino)-3-morpholin-4-yl-1-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,3Z)-2,3-bis(hydroxyimino)-3-morpholin-4-yl-1-phenylpropan-1-one?
The IUPAC name of (2Z,3Z)-2,3-bis(hydroxyimino)-3-morpholin-4-yl-1-phenylpropan-1-one (CID 137153092) is (2Z,3Z)-2,3-bis(hydroxyimino)-3-morpholin-4-yl-1-phenylpropan-1-one.
What is the SMILES notation for (2Z,3Z)-2,3-bis(hydroxyimino)-3-morpholin-4-yl-1-phenylpropan-1-one?
The canonical SMILES for (2Z,3Z)-2,3-bis(hydroxyimino)-3-morpholin-4-yl-1-phenylpropan-1-one is O=C(C(=N\O)/C(=N/O)N1CCOCC1)c1ccccc1.
What is the InChIKey of (2Z,3Z)-2,3-bis(hydroxyimino)-3-morpholin-4-yl-1-phenylpropan-1-one?
The InChIKey is QKBWAOXQNRKNRK-HKHVJCFFSA-N. The full InChI is InChI=1S/C13H15N3O4/c17-12(10-4-2-1-3-5-10)11(14-18)13(15-19)16-6-8-20-9-7-16/h1-5,18-19H,6-9H2/b14-11+,15-13-.
What are the key properties of (2Z,3Z)-2,3-bis(hydroxyimino)-3-morpholin-4-yl-1-phenylpropan-1-one?
(2Z,3Z)-2,3-bis(hydroxyimino)-3-morpholin-4-yl-1-phenylpropan-1-one has a molecular weight of 277.28 g/mol, XLogP of 0.82, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,3Z)-2,3-bis(hydroxyimino)-3-morpholin-4-yl-1-phenylpropan-1-one is sourced from PubChem (CID 137153092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).