C31H25NO4 — CID 71723118
3-benzoyl-2-morpholin-4-yl-1-naphthalen-2-yl-4-phenylbut-2-ene-1,4-dione (PubChem CID 71723118) has the molecular formula C31H25NO4 and a molecular weight of 475.54 g/mol. Its IUPAC name is 3-benzoyl-2-morpholin-4-yl-1-naphthalen-2-yl-4-phenylbut-2-ene-1,4-dione.
| Compound Name | 3-benzoyl-2-morpholin-4-yl-1-naphthalen-2-yl-4-phenylbut-2-ene-1,4-dione |
|---|---|
| PubChem CID | 71723118 |
| Molecular Formula | C31H25NO4 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 3-benzoyl-2-morpholin-4-yl-1-naphthalen-2-yl-4-phenylbut-2-ene-1,4-dione |
| SMILES | O=C(C(C(=O)c1ccccc1)=C(C(=O)c1ccc2ccccc2c1)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C31H25NO4/c33-29(23-10-3-1-4-11-23)27(30(34)24-12-5-2-6-13-24)28(32-17-19-36-20-18-32)31(35)26-16-15-22-9-7-8-14-25(22)21-26/h1-16,21H,17-20H2 |
| InChIKey | GXGPWEDXZFBXOR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|