C14H15F2NO3 — CID 67647751
4,4-difluoro-4-morpholin-4-yl-1-phenylbutane-1,3-dione (PubChem CID 67647751) has the molecular formula C14H15F2NO3 and a molecular weight of 283.27 g/mol. Its IUPAC name is 4,4-difluoro-4-morpholin-4-yl-1-phenylbutane-1,3-dione.
| Compound Name | 4,4-difluoro-4-morpholin-4-yl-1-phenylbutane-1,3-dione |
|---|---|
| PubChem CID | 67647751 |
| Molecular Formula | C14H15F2NO3 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 4,4-difluoro-4-morpholin-4-yl-1-phenylbutane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C14H15F2NO3/c15-14(16,17-6-8-20-9-7-17)13(19)10-12(18)11-4-2-1-3-5-11/h1-5H,6-10H2 |
| InChIKey | UVQOEFZPJFHWGC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|