C13H20N2O3 — CID 123508124
N-(2-morpholin-4-yl-2-oxoethyl)-2-propan-2-ylbuta-2,3-dienamide (PubChem CID 123508124) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-2-oxoethyl)-2-propan-2-ylbuta-2,3-dienamide.
| Compound Name | N-(2-morpholin-4-yl-2-oxoethyl)-2-propan-2-ylbuta-2,3-dienamide |
|---|---|
| PubChem CID | 123508124 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | N-(2-morpholin-4-yl-2-oxoethyl)-2-propan-2-ylbuta-2,3-dienamide |
| SMILES | C=C=C(C(=O)NCC(=O)N1CCOCC1)C(C)C |
| InChI | InChI=1S/C13H20N2O3/c1-4-11(10(2)3)13(17)14-9-12(16)15-5-7-18-8-6-15/h10H,1,5-9H2,2-3H3,(H,14,17) |
| InChIKey | DONPYEVEVMFCNK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|