C11H17N3O2 — CID 121217955
3,3-dimorpholin-4-ylprop-2-enenitrile (PubChem CID 121217955) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 3,3-dimorpholin-4-ylprop-2-enenitrile.
| Compound Name | 3,3-dimorpholin-4-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 121217955 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 3,3-dimorpholin-4-ylprop-2-enenitrile |
| SMILES | N#CC=C(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C11H17N3O2/c12-2-1-11(13-3-7-15-8-4-13)14-5-9-16-10-6-14/h1H,3-10H2 |
| InChIKey | CRGBJTFIVXYPSH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 48.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|