C14H23NO — CID 166476539
4-[(3E)-4,6-dimethyl-5-methylidenehepta-1,3-dien-3-yl]morpholine (PubChem CID 166476539) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 4-[(3E)-4,6-dimethyl-5-methylidenehepta-1,3-dien-3-yl]morpholine.
| Compound Name | 4-[(3E)-4,6-dimethyl-5-methylidenehepta-1,3-dien-3-yl]morpholine |
|---|---|
| PubChem CID | 166476539 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 4-[(3E)-4,6-dimethyl-5-methylidenehepta-1,3-dien-3-yl]morpholine |
| SMILES | C=C/C(=C(/C)C(=C)C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C14H23NO/c1-6-14(13(5)12(4)11(2)3)15-7-9-16-10-8-15/h6,11H,1,4,7-10H2,2-3,5H3/b14-13+ |
| InChIKey | KLBBTSUVGYRIQK-BUHFOSPRSA-N |
| XLogP | 2.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|