C11H18N2O — CID 170440486
N-[(1Z)-3-methylbuta-1,3-dienyl]-1-morpholin-4-ylethanimine (PubChem CID 170440486) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is N-[(1Z)-3-methylbuta-1,3-dienyl]-1-morpholin-4-ylethanimine.
| Compound Name | N-[(1Z)-3-methylbuta-1,3-dienyl]-1-morpholin-4-ylethanimine |
|---|---|
| PubChem CID | 170440486 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-[(1Z)-3-methylbuta-1,3-dienyl]-1-morpholin-4-ylethanimine |
| SMILES | C=C(C)/C=C\N=C(/C)N1CCOCC1 |
| InChI | InChI=1S/C11H18N2O/c1-10(2)4-5-12-11(3)13-6-8-14-9-7-13/h4-5H,1,6-9H2,2-3H3/b5-4-,12-11+ |
| InChIKey | DENBUDBSLVKUQY-LKYDAOQMSA-N |
| XLogP | 1.83 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|