C8H16N2O — CID 142039322
N,N-dimethyl-1-morpholin-4-ylethenamine (PubChem CID 142039322) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is N,N-dimethyl-1-morpholin-4-ylethenamine.
| Compound Name | N,N-dimethyl-1-morpholin-4-ylethenamine |
|---|---|
| PubChem CID | 142039322 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | N,N-dimethyl-1-morpholin-4-ylethenamine |
| SMILES | C=C(N(C)C)N1CCOCC1 |
| InChI | InChI=1S/C8H16N2O/c1-8(9(2)3)10-4-6-11-7-5-10/h1,4-7H2,2-3H3 |
| InChIKey | KTYOTCVYQHLGMD-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |