C9H16N2O2 — CID 174472368
N,2-dimethyl-N-morpholin-4-ylprop-2-enamide (PubChem CID 174472368) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is N,2-dimethyl-N-morpholin-4-ylprop-2-enamide.
| Compound Name | N,2-dimethyl-N-morpholin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 174472368 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | N,2-dimethyl-N-morpholin-4-ylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)N1CCOCC1 |
| InChI | InChI=1S/C9H16N2O2/c1-8(2)9(12)10(3)11-4-6-13-7-5-11/h1,4-7H2,2-3H3 |
| InChIKey | QBMRSRLGFIGFFK-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|