About 2-piperidin-3-ylethyl morpholine-4-carboxylate
2-piperidin-3-ylethyl morpholine-4-carboxylate (PubChem CID 79337439) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-piperidin-3-ylethyl morpholine-4-carboxylate.
Molecular Properties
| Compound Name | 2-piperidin-3-ylethyl morpholine-4-carboxylate |
| PubChem CID | 79337439 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 2-piperidin-3-ylethyl morpholine-4-carboxylate |
| SMILES | O=C(OCCC1CCCNC1)N1CCOCC1 |
| InChI | InChI=1S/C12H22N2O3/c15-12(14-5-8-16-9-6-14)17-7-3-11-2-1-4-13-10-11/h11,13H,1-10H2 |
| InChIKey | FEIBJFGQSQCUQH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperidin-3-ylethyl morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-3-ylethyl morpholine-4-carboxylate?
The IUPAC name of 2-piperidin-3-ylethyl morpholine-4-carboxylate (CID 79337439) is 2-piperidin-3-ylethyl morpholine-4-carboxylate.
What is the SMILES notation for 2-piperidin-3-ylethyl morpholine-4-carboxylate?
The canonical SMILES for 2-piperidin-3-ylethyl morpholine-4-carboxylate is O=C(OCCC1CCCNC1)N1CCOCC1.
What is the InChIKey of 2-piperidin-3-ylethyl morpholine-4-carboxylate?
The InChIKey is FEIBJFGQSQCUQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3/c15-12(14-5-8-16-9-6-14)17-7-3-11-2-1-4-13-10-11/h11,13H,1-10H2.
What are the key properties of 2-piperidin-3-ylethyl morpholine-4-carboxylate?
2-piperidin-3-ylethyl morpholine-4-carboxylate has a molecular weight of 242.32 g/mol, XLogP of 0.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-3-ylethyl morpholine-4-carboxylate is sourced from PubChem (CID 79337439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).