C13H26ClN3O2 — CID 119930321
2-[methyl(piperidin-3-ylmethyl)amino]-1-morpholin-4-ylethanone;hydrochloride (PubChem CID 119930321) has the molecular formula C13H26ClN3O2 and a molecular weight of 291.82 g/mol. Its IUPAC name is 2-[methyl(piperidin-3-ylmethyl)amino]-1-morpholin-4-ylethanone;hydrochloride.
| Compound Name | 2-[methyl(piperidin-3-ylmethyl)amino]-1-morpholin-4-ylethanone;hydrochloride |
|---|---|
| PubChem CID | 119930321 |
| Molecular Formula | C13H26ClN3O2 |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-[methyl(piperidin-3-ylmethyl)amino]-1-morpholin-4-ylethanone;hydrochloride |
| SMILES | CN(CC(=O)N1CCOCC1)CC1CCCNC1.Cl |
| InChI | InChI=1S/C13H25N3O2.ClH/c1-15(10-12-3-2-4-14-9-12)11-13(17)16-5-7-18-8-6-16;/h12,14H,2-11H2,1H3;1H |
| InChIKey | XVCSLGXRKOXALK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |