About azetidin-3-yl 4-methylpiperidine-1-carboxylate
azetidin-3-yl 4-methylpiperidine-1-carboxylate (PubChem CID 79337031) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is azetidin-3-yl 4-methylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | azetidin-3-yl 4-methylpiperidine-1-carboxylate |
| PubChem CID | 79337031 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | azetidin-3-yl 4-methylpiperidine-1-carboxylate |
| SMILES | CC1CCN(C(=O)OC2CNC2)CC1 |
| InChI | InChI=1S/C10H18N2O2/c1-8-2-4-12(5-3-8)10(13)14-9-6-11-7-9/h8-9,11H,2-7H2,1H3 |
| InChIKey | MMRYVLRGCKGJAA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azetidin-3-yl 4-methylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-3-yl 4-methylpiperidine-1-carboxylate?
The IUPAC name of azetidin-3-yl 4-methylpiperidine-1-carboxylate (CID 79337031) is azetidin-3-yl 4-methylpiperidine-1-carboxylate.
What is the SMILES notation for azetidin-3-yl 4-methylpiperidine-1-carboxylate?
The canonical SMILES for azetidin-3-yl 4-methylpiperidine-1-carboxylate is CC1CCN(C(=O)OC2CNC2)CC1.
What is the InChIKey of azetidin-3-yl 4-methylpiperidine-1-carboxylate?
The InChIKey is MMRYVLRGCKGJAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-8-2-4-12(5-3-8)10(13)14-9-6-11-7-9/h8-9,11H,2-7H2,1H3.
What are the key properties of azetidin-3-yl 4-methylpiperidine-1-carboxylate?
azetidin-3-yl 4-methylpiperidine-1-carboxylate has a molecular weight of 198.27 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-3-yl 4-methylpiperidine-1-carboxylate is sourced from PubChem (CID 79337031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).