About methyl 4-methylpiperidine-1-carboxylate;4-methyloxane
methyl 4-methylpiperidine-1-carboxylate;4-methyloxane (PubChem CID 90741122) has the molecular formula C14H27NO3
and a molecular weight of 257.37 g/mol. Its IUPAC name is methyl 4-methylpiperidine-1-carboxylate;4-methyloxane.
Molecular Properties
| Compound Name | methyl 4-methylpiperidine-1-carboxylate;4-methyloxane |
| PubChem CID | 90741122 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | methyl 4-methylpiperidine-1-carboxylate;4-methyloxane |
| SMILES | CC1CCOCC1.COC(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C8H15NO2.C6H12O/c1-7-3-5-9(6-4-7)8(10)11-2;1-6-2-4-7-5-3-6/h7H,3-6H2,1-2H3;6H,2-5H2,1H3 |
| InChIKey | RSKBZTFPHMELOP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-methylpiperidine-1-carboxylate;4-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methylpiperidine-1-carboxylate;4-methyloxane?
The IUPAC name of methyl 4-methylpiperidine-1-carboxylate;4-methyloxane (CID 90741122) is methyl 4-methylpiperidine-1-carboxylate;4-methyloxane.
What is the SMILES notation for methyl 4-methylpiperidine-1-carboxylate;4-methyloxane?
The canonical SMILES for methyl 4-methylpiperidine-1-carboxylate;4-methyloxane is CC1CCOCC1.COC(=O)N1CCC(C)CC1.
What is the InChIKey of methyl 4-methylpiperidine-1-carboxylate;4-methyloxane?
The InChIKey is RSKBZTFPHMELOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C6H12O/c1-7-3-5-9(6-4-7)8(10)11-2;1-6-2-4-7-5-3-6/h7H,3-6H2,1-2H3;6H,2-5H2,1H3.
What are the key properties of methyl 4-methylpiperidine-1-carboxylate;4-methyloxane?
methyl 4-methylpiperidine-1-carboxylate;4-methyloxane has a molecular weight of 257.37 g/mol, XLogP of 2.92, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methylpiperidine-1-carboxylate;4-methyloxane is sourced from PubChem (CID 90741122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).