methyl 4-methylpiperidine-1-carboxylate;4-methyloxane

C14H27NO3 — CID 90741122

IUPACmethyl 4-methylpiperidine-1-carboxylate;4-methyloxane
SMILESCC1CCOCC1.COC(=O)N1CCC(C)CC1
InChIInChI=1S/C8H15NO2.C6H12O/c1-7-3-5-9(6-4-7)8(10)11-2;1-6-2-4-7-5-3-6/h7H,3-6H2,1-2H3;6H,2-5H2,1H3
InChIKeyRSKBZTFPHMELOP-UHFFFAOYSA-N
MW257.37 g/mol
LogP2.92
Rot. Bonds

About methyl 4-methylpiperidine-1-carboxylate;4-methyloxane

methyl 4-methylpiperidine-1-carboxylate;4-methyloxane (PubChem CID 90741122) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is methyl 4-methylpiperidine-1-carboxylate;4-methyloxane.

Molecular Properties

Compound Namemethyl 4-methylpiperidine-1-carboxylate;4-methyloxane
PubChem CID90741122
Molecular FormulaC14H27NO3
Molecular Weight257.37 g/mol
Exact Mass257.20
IUPAC Namemethyl 4-methylpiperidine-1-carboxylate;4-methyloxane
SMILESCC1CCOCC1.COC(=O)N1CCC(C)CC1
InChIInChI=1S/C8H15NO2.C6H12O/c1-7-3-5-9(6-4-7)8(10)11-2;1-6-2-4-7-5-3-6/h7H,3-6H2,1-2H3;6H,2-5H2,1H3
InChIKeyRSKBZTFPHMELOP-UHFFFAOYSA-N
XLogP2.92
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.37
LogP ≤ 52.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 4-methylpiperidine-1-carboxylate;4-methyloxane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-methylpiperidine-1-carboxylate;4-methyloxane?
The IUPAC name of methyl 4-methylpiperidine-1-carboxylate;4-methyloxane (CID 90741122) is methyl 4-methylpiperidine-1-carboxylate;4-methyloxane.
What is the SMILES notation for methyl 4-methylpiperidine-1-carboxylate;4-methyloxane?
The canonical SMILES for methyl 4-methylpiperidine-1-carboxylate;4-methyloxane is CC1CCOCC1.COC(=O)N1CCC(C)CC1.
What is the InChIKey of methyl 4-methylpiperidine-1-carboxylate;4-methyloxane?
The InChIKey is RSKBZTFPHMELOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C6H12O/c1-7-3-5-9(6-4-7)8(10)11-2;1-6-2-4-7-5-3-6/h7H,3-6H2,1-2H3;6H,2-5H2,1H3.
What are the key properties of methyl 4-methylpiperidine-1-carboxylate;4-methyloxane?
methyl 4-methylpiperidine-1-carboxylate;4-methyloxane has a molecular weight of 257.37 g/mol, XLogP of 2.92, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methylpiperidine-1-carboxylate;4-methyloxane is sourced from PubChem (CID 90741122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).