C26H48N6O10 — CID 21316321
tetramethyl 4,7-dioxa-1,10,13,16,21,24-hexazabicyclo[8.8.8]hexacosane-13,16,21,24-tetracarboxylate (PubChem CID 21316321) has the molecular formula C26H48N6O10 and a molecular weight of 604.70 g/mol. Its IUPAC name is tetramethyl 4,7-dioxa-1,10,13,16,21,24-hexazabicyclo[8.8.8]hexacosane-13,16,21,24-tetracarboxylate.
| Compound Name | tetramethyl 4,7-dioxa-1,10,13,16,21,24-hexazabicyclo[8.8.8]hexacosane-13,16,21,24-tetracarboxylate |
|---|---|
| PubChem CID | 21316321 |
| Molecular Formula | C26H48N6O10 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.34 |
| IUPAC Name | tetramethyl 4,7-dioxa-1,10,13,16,21,24-hexazabicyclo[8.8.8]hexacosane-13,16,21,24-tetracarboxylate |
| SMILES | COC(=O)N1CCN2CCOCCOCCN(CCN(C(=O)OC)CC1)CCN(C(=O)OC)CCN(C(=O)OC)CC2 |
| InChI | InChI=1S/C26H48N6O10/c1-37-23(33)29-9-5-27-6-11-31(25(35)39-3)15-16-32(26(36)40-4)12-8-28(18-20-42-22-21-41-19-17-27)7-10-30(14-13-29)24(34)38-2/h5-22H2,1-4H3 |
| InChIKey | VKMRKMFCZBUDAK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 143.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|