C19H33N3O3 — CID 42842351
methyl 4-[1-cyclopentyl-2-(4-methylpiperidin-1-yl)-2-oxoethyl]piperazine-1-carboxylate (PubChem CID 42842351) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is methyl 4-[1-cyclopentyl-2-(4-methylpiperidin-1-yl)-2-oxoethyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[1-cyclopentyl-2-(4-methylpiperidin-1-yl)-2-oxoethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 42842351 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | methyl 4-[1-cyclopentyl-2-(4-methylpiperidin-1-yl)-2-oxoethyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(C(C(=O)N2CCC(C)CC2)C2CCCC2)CC1 |
| InChI | InChI=1S/C19H33N3O3/c1-15-7-9-21(10-8-15)18(23)17(16-5-3-4-6-16)20-11-13-22(14-12-20)19(24)25-2/h15-17H,3-14H2,1-2H3 |
| InChIKey | QCRNCCDVSCROFO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |