C26H37N3O2 — CID 42842348
(E)-1-[4-[1-cyclopentyl-2-(4-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 42842348) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is (E)-1-[4-[1-cyclopentyl-2-(4-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[1-cyclopentyl-2-(4-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 42842348 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | (E)-1-[4-[1-cyclopentyl-2-(4-methylpiperidin-1-yl)-2-oxoethyl]piperazin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | CC1CCN(C(=O)C(C2CCCC2)N2CCN(C(=O)/C=C/c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C26H37N3O2/c1-21-13-15-29(16-14-21)26(31)25(23-9-5-6-10-23)28-19-17-27(18-20-28)24(30)12-11-22-7-3-2-4-8-22/h2-4,7-8,11-12,21,23,25H,5-6,9-10,13-20H2,1H3/b12-11+ |
| InChIKey | QXRJAXBSFGZGNB-VAWYXSNFSA-N |
| XLogP | 3.66 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|