C24H33N3O2 — CID 42842736
(E)-1-[4-(1-cyclopentyl-2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 42842736) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is (E)-1-[4-(1-cyclopentyl-2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(1-cyclopentyl-2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 42842736 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | (E)-1-[4-(1-cyclopentyl-2-oxo-2-pyrrolidin-1-ylethyl)piperazin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1CCN(C(C(=O)N2CCCC2)C2CCCC2)CC1 |
| InChI | InChI=1S/C24H33N3O2/c28-22(13-12-20-8-2-1-3-9-20)25-16-18-26(19-17-25)23(21-10-4-5-11-21)24(29)27-14-6-7-15-27/h1-3,8-9,12-13,21,23H,4-7,10-11,14-19H2/b13-12+ |
| InChIKey | WDBHPOJPPUHSFW-OUKQBFOZSA-N |
| XLogP | 3.03 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|