C24H33N3O2 — CID 134020859
(E)-1-[4-(4-cyclopentylpiperazine-1-carbonyl)piperidin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 134020859) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is (E)-1-[4-(4-cyclopentylpiperazine-1-carbonyl)piperidin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-cyclopentylpiperazine-1-carbonyl)piperidin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 134020859 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | (E)-1-[4-(4-cyclopentylpiperazine-1-carbonyl)piperidin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1CCC(C(=O)N2CCN(C3CCCC3)CC2)CC1 |
| InChI | InChI=1S/C24H33N3O2/c28-23(11-10-20-6-2-1-3-7-20)26-14-12-21(13-15-26)24(29)27-18-16-25(17-19-27)22-8-4-5-9-22/h1-3,6-7,10-11,21-22H,4-5,8-9,12-19H2/b11-10+ |
| InChIKey | GKKBRQYYSSFAAM-ZHACJKMWSA-N |
| XLogP | 3.03 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|