C29H36N4O2 — CID 68776266
1-[4-[2-(4-cyclobutylpiperazin-1-yl)-2-oxoethyl]piperazin-1-yl]-3-(4-phenylphenyl)prop-2-en-1-one (PubChem CID 68776266) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 1-[4-[2-(4-cyclobutylpiperazin-1-yl)-2-oxoethyl]piperazin-1-yl]-3-(4-phenylphenyl)prop-2-en-1-one.
| Compound Name | 1-[4-[2-(4-cyclobutylpiperazin-1-yl)-2-oxoethyl]piperazin-1-yl]-3-(4-phenylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 68776266 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 1-[4-[2-(4-cyclobutylpiperazin-1-yl)-2-oxoethyl]piperazin-1-yl]-3-(4-phenylphenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(-c2ccccc2)cc1)N1CCN(CC(=O)N2CCN(C3CCC3)CC2)CC1 |
| InChI | InChI=1S/C29H36N4O2/c34-28(14-11-24-9-12-26(13-10-24)25-5-2-1-3-6-25)32-17-15-30(16-18-32)23-29(35)33-21-19-31(20-22-33)27-7-4-8-27/h1-3,5-6,9-14,27H,4,7-8,15-23H2 |
| InChIKey | SKTUDIGZIRGGTM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|