C28H38N4O — CID 57442367
2-(4-benzhydrylpiperazin-1-yl)-1-(4-cyclopentylpiperazin-1-yl)ethanone (PubChem CID 57442367) has the molecular formula C28H38N4O and a molecular weight of 446.64 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazin-1-yl)-1-(4-cyclopentylpiperazin-1-yl)ethanone.
| Compound Name | 2-(4-benzhydrylpiperazin-1-yl)-1-(4-cyclopentylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 57442367 |
| Molecular Formula | C28H38N4O |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 2-(4-benzhydrylpiperazin-1-yl)-1-(4-cyclopentylpiperazin-1-yl)ethanone |
| SMILES | O=C(CN1CCN(C(c2ccccc2)c2ccccc2)CC1)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C28H38N4O/c33-27(31-21-19-30(20-22-31)26-13-7-8-14-26)23-29-15-17-32(18-16-29)28(24-9-3-1-4-10-24)25-11-5-2-6-12-25/h1-6,9-12,26,28H,7-8,13-23H2 |
| InChIKey | OMYQRGYYGRJFBU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |