C23H36N4O — CID 134483239
2-(4-cyclohexylpiperazin-1-yl)-1-[4-(2-methylphenyl)piperazin-1-yl]ethanone (PubChem CID 134483239) has the molecular formula C23H36N4O and a molecular weight of 384.57 g/mol. Its IUPAC name is 2-(4-cyclohexylpiperazin-1-yl)-1-[4-(2-methylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(4-cyclohexylpiperazin-1-yl)-1-[4-(2-methylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 134483239 |
| Molecular Formula | C23H36N4O |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 2-(4-cyclohexylpiperazin-1-yl)-1-[4-(2-methylphenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1ccccc1N1CCN(C(=O)CN2CCN(C3CCCCC3)CC2)CC1 |
| InChI | InChI=1S/C23H36N4O/c1-20-7-5-6-10-22(20)26-15-17-27(18-16-26)23(28)19-24-11-13-25(14-12-24)21-8-3-2-4-9-21/h5-7,10,21H,2-4,8-9,11-19H2,1H3 |
| InChIKey | SODFWFCSRFKMSE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |