C24H32N6O — CID 57443163
1-(4-cyclobutylpiperazin-1-yl)-2-[4-(4-pyrimidin-5-ylphenyl)piperazin-1-yl]ethanone (PubChem CID 57443163) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is 1-(4-cyclobutylpiperazin-1-yl)-2-[4-(4-pyrimidin-5-ylphenyl)piperazin-1-yl]ethanone.
| Compound Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[4-(4-pyrimidin-5-ylphenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 57443163 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[4-(4-pyrimidin-5-ylphenyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(c2ccc(-c3cncnc3)cc2)CC1)N1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C24H32N6O/c31-24(30-14-12-29(13-15-30)22-2-1-3-22)18-27-8-10-28(11-9-27)23-6-4-20(5-7-23)21-16-25-19-26-17-21/h4-7,16-17,19,22H,1-3,8-15,18H2 |
| InChIKey | ZUGHQQQHMMVFLU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |