C22H33N5O — CID 143404331
1-(4-cyclobutylpiperazin-1-yl)-2-[4-[4-(methyliminomethyl)phenyl]piperazin-1-yl]ethanone (PubChem CID 143404331) has the molecular formula C22H33N5O and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-(4-cyclobutylpiperazin-1-yl)-2-[4-[4-(methyliminomethyl)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[4-[4-(methyliminomethyl)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 143404331 |
| Molecular Formula | C22H33N5O |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[4-[4-(methyliminomethyl)phenyl]piperazin-1-yl]ethanone |
| SMILES | C/N=C/c1ccc(N2CCN(CC(=O)N3CCN(C4CCC4)CC3)CC2)cc1 |
| InChI | InChI=1S/C22H33N5O/c1-23-17-19-5-7-21(8-6-19)25-11-9-24(10-12-25)18-22(28)27-15-13-26(14-16-27)20-3-2-4-20/h5-8,17,20H,2-4,9-16,18H2,1H3/b23-17+ |
| InChIKey | DXKJRDXHOGWHLU-HAVVHWLPSA-N |
| XLogP | 1.55 |
| TPSA | 42.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|