C27H41N5O2 — CID 57442566
2-[4-[4-(azepane-1-carbonyl)phenyl]piperazin-1-yl]-1-(4-cyclobutylpiperazin-1-yl)ethanone (PubChem CID 57442566) has the molecular formula C27H41N5O2 and a molecular weight of 467.66 g/mol. Its IUPAC name is 2-[4-[4-(azepane-1-carbonyl)phenyl]piperazin-1-yl]-1-(4-cyclobutylpiperazin-1-yl)ethanone.
| Compound Name | 2-[4-[4-(azepane-1-carbonyl)phenyl]piperazin-1-yl]-1-(4-cyclobutylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 57442566 |
| Molecular Formula | C27H41N5O2 |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.33 |
| IUPAC Name | 2-[4-[4-(azepane-1-carbonyl)phenyl]piperazin-1-yl]-1-(4-cyclobutylpiperazin-1-yl)ethanone |
| SMILES | O=C(CN1CCN(c2ccc(C(=O)N3CCCCCC3)cc2)CC1)N1CCN(C2CCC2)CC1 |
| InChI | InChI=1S/C27H41N5O2/c33-26(31-20-18-30(19-21-31)24-6-5-7-24)22-28-14-16-29(17-15-28)25-10-8-23(9-11-25)27(34)32-12-3-1-2-4-13-32/h8-11,24H,1-7,12-22H2 |
| InChIKey | GBPLPUXVTIDTRH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 50.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |