C26H39N3O2 — CID 69354891
[4-[4-(1-cyclobutylpiperidin-4-yl)oxypiperidin-1-yl]phenyl]-piperidin-1-ylmethanone (PubChem CID 69354891) has the molecular formula C26H39N3O2 and a molecular weight of 425.62 g/mol. Its IUPAC name is [4-[4-(1-cyclobutylpiperidin-4-yl)oxypiperidin-1-yl]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-[4-(1-cyclobutylpiperidin-4-yl)oxypiperidin-1-yl]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 69354891 |
| Molecular Formula | C26H39N3O2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | [4-[4-(1-cyclobutylpiperidin-4-yl)oxypiperidin-1-yl]phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(N2CCC(OC3CCN(C4CCC4)CC3)CC2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C26H39N3O2/c30-26(29-15-2-1-3-16-29)21-7-9-23(10-8-21)28-19-13-25(14-20-28)31-24-11-17-27(18-12-24)22-5-4-6-22/h7-10,22,24-25H,1-6,11-20H2 |
| InChIKey | KZRVFYGOPLIDJO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |