C23H34N4O2S — CID 57442752
1-(4-cyclobutylpiperazin-1-yl)-2-[4-(4-ethylsulfanylbenzoyl)piperazin-1-yl]ethanone (PubChem CID 57442752) has the molecular formula C23H34N4O2S and a molecular weight of 430.62 g/mol. Its IUPAC name is 1-(4-cyclobutylpiperazin-1-yl)-2-[4-(4-ethylsulfanylbenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[4-(4-ethylsulfanylbenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 57442752 |
| Molecular Formula | C23H34N4O2S |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 1-(4-cyclobutylpiperazin-1-yl)-2-[4-(4-ethylsulfanylbenzoyl)piperazin-1-yl]ethanone |
| SMILES | CCSc1ccc(C(=O)N2CCN(CC(=O)N3CCN(C4CCC4)CC3)CC2)cc1 |
| InChI | InChI=1S/C23H34N4O2S/c1-2-30-21-8-6-19(7-9-21)23(29)27-12-10-24(11-13-27)18-22(28)26-16-14-25(15-17-26)20-4-3-5-20/h6-9,20H,2-5,10-18H2,1H3 |
| InChIKey | IIZBRTFDOJJTMA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |