C21H39NO2 — CID 155468911
(1-methylcycloundecyl) 4,4-dimethylazepane-1-carboxylate (PubChem CID 155468911) has the molecular formula C21H39NO2 and a molecular weight of 337.55 g/mol. Its IUPAC name is (1-methylcycloundecyl) 4,4-dimethylazepane-1-carboxylate.
| Compound Name | (1-methylcycloundecyl) 4,4-dimethylazepane-1-carboxylate |
|---|---|
| PubChem CID | 155468911 |
| Molecular Formula | C21H39NO2 |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.30 |
| IUPAC Name | (1-methylcycloundecyl) 4,4-dimethylazepane-1-carboxylate |
| SMILES | CC1(C)CCCN(C(=O)OC2(C)CCCCCCCCCC2)CC1 |
| InChI | InChI=1S/C21H39NO2/c1-20(2)13-12-17-22(18-16-20)19(23)24-21(3)14-10-8-6-4-5-7-9-11-15-21/h4-18H2,1-3H3 |
| InChIKey | LROLIQFFMGQEPL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |