C12H22N4O — CID 10014450
1-[(2S)-2,6-diaminohexanoyl]piperidine-2-carbonitrile (PubChem CID 10014450) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-[(2S)-2,6-diaminohexanoyl]piperidine-2-carbonitrile.
| Compound Name | 1-[(2S)-2,6-diaminohexanoyl]piperidine-2-carbonitrile |
|---|---|
| PubChem CID | 10014450 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 1-[(2S)-2,6-diaminohexanoyl]piperidine-2-carbonitrile |
| SMILES | N#CC1CCCCN1C(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C12H22N4O/c13-7-3-1-6-11(15)12(17)16-8-4-2-5-10(16)9-14/h10-11H,1-8,13,15H2/t10?,11-/m0/s1 |
| InChIKey | RVIRSPCRFRPYII-DTIOYNMSSA-N |
| XLogP | 0.35 |
| TPSA | 96.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|