C28H34N4O — CID 91001980
(2S)-1-[(2S)-2-amino-5-[bis(3-phenylprop-2-enyl)amino]pentanoyl]pyrrolidine-2-carbonitrile (PubChem CID 91001980) has the molecular formula C28H34N4O and a molecular weight of 442.61 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-amino-5-[bis(3-phenylprop-2-enyl)amino]pentanoyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S)-1-[(2S)-2-amino-5-[bis(3-phenylprop-2-enyl)amino]pentanoyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 91001980 |
| Molecular Formula | C28H34N4O |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | (2S)-1-[(2S)-2-amino-5-[bis(3-phenylprop-2-enyl)amino]pentanoyl]pyrrolidine-2-carbonitrile |
| SMILES | N#C[C@@H]1CCCN1C(=O)[C@@H](N)CCCN(CC=Cc1ccccc1)CC=Cc1ccccc1 |
| InChI | InChI=1S/C28H34N4O/c29-23-26-17-9-22-32(26)28(33)27(30)18-10-21-31(19-7-15-24-11-3-1-4-12-24)20-8-16-25-13-5-2-6-14-25/h1-8,11-16,26-27H,9-10,17-22,30H2/t26-,27-/m0/s1 |
| InChIKey | MCBLVWKKFPLLJW-SVBPBHIXSA-N |
| XLogP | 4.34 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |