C20H28N4O — CID 69236639
(2S)-1-[(2S)-6-amino-2-(3-phenylprop-2-enylamino)hexanoyl]pyrrolidine-2-carbonitrile (PubChem CID 69236639) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is (2S)-1-[(2S)-6-amino-2-(3-phenylprop-2-enylamino)hexanoyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S)-1-[(2S)-6-amino-2-(3-phenylprop-2-enylamino)hexanoyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 69236639 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | (2S)-1-[(2S)-6-amino-2-(3-phenylprop-2-enylamino)hexanoyl]pyrrolidine-2-carbonitrile |
| SMILES | N#C[C@@H]1CCCN1C(=O)[C@H](CCCCN)NCC=Cc1ccccc1 |
| InChI | InChI=1S/C20H28N4O/c21-13-5-4-12-19(20(25)24-15-7-11-18(24)16-22)23-14-6-10-17-8-2-1-3-9-17/h1-3,6,8-10,18-19,23H,4-5,7,11-15,21H2/t18-,19-/m0/s1 |
| InChIKey | SXWXFALRLCPJTK-OALUTQOASA-N |
| XLogP | 2.30 |
| TPSA | 82.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|